C17H21N3O5S2 — CID 23553791
3-[(4-acetamidophenyl)sulfonyl-(2-thiophen-2-ylethyl)amino]-N-hydroxypropanamide (PubChem CID 23553791) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[(4-acetamidophenyl)sulfonyl-(2-thiophen-2-ylethyl)amino]-N-hydroxypropanamide.
| Compound Name | 3-[(4-acetamidophenyl)sulfonyl-(2-thiophen-2-ylethyl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23553791 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 3-[(4-acetamidophenyl)sulfonyl-(2-thiophen-2-ylethyl)amino]-N-hydroxypropanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCC(=O)NO)CCc2cccs2)cc1 |
| InChI | InChI=1S/C17H21N3O5S2/c1-13(21)18-14-4-6-16(7-5-14)27(24,25)20(11-9-17(22)19-23)10-8-15-3-2-12-26-15/h2-7,12,23H,8-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | CRHMKRVFOVPBJM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|