C26H27F3N4O6S — CID 71452286
N-hydroxy-3-[2-(4-methoxyphenyl)ethyl-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]propanamide (PubChem CID 71452286) has the molecular formula C26H27F3N4O6S and a molecular weight of 580.59 g/mol. Its IUPAC name is N-hydroxy-3-[2-(4-methoxyphenyl)ethyl-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]propanamide.
| Compound Name | N-hydroxy-3-[2-(4-methoxyphenyl)ethyl-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 71452286 |
| Molecular Formula | C26H27F3N4O6S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | N-hydroxy-3-[2-(4-methoxyphenyl)ethyl-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]propanamide |
| SMILES | COc1ccc(CCN(CCC(=O)NO)S(=O)(=O)c2ccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H27F3N4O6S/c1-39-22-10-2-18(3-11-22)14-16-33(17-15-24(34)32-36)40(37,38)23-12-8-21(9-13-23)31-25(35)30-20-6-4-19(5-7-20)26(27,28)29/h2-13,36H,14-17H2,1H3,(H,32,34)(H2,30,31,35) |
| InChIKey | FDYXBAVDGXDQNF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|