C19H24N2O5S — CID 18678924
methyl 3-[(4-aminophenyl)sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]propanoate (PubChem CID 18678924) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl 3-[(4-aminophenyl)sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]propanoate.
| Compound Name | methyl 3-[(4-aminophenyl)sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 18678924 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 3-[(4-aminophenyl)sulfonyl-[2-(4-methoxyphenyl)ethyl]amino]propanoate |
| SMILES | COC(=O)CCN(CCc1ccc(OC)cc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-25-17-7-3-15(4-8-17)11-13-21(14-12-19(22)26-2)27(23,24)18-9-5-16(20)6-10-18/h3-10H,11-14,20H2,1-2H3 |
| InChIKey | KZPKSHFDZPQQPS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|