C21H27NO6S — CID 70003352
2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid (PubChem CID 70003352) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid.
| Compound Name | 2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 70003352 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid |
| SMILES | CCC(CN(CCc1ccc(OC)cc1)S(=O)(=O)c1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C21H27NO6S/c1-4-17(21(23)24)15-22(14-13-16-5-7-18(27-2)8-6-16)29(25,26)20-11-9-19(28-3)10-12-20/h5-12,17H,4,13-15H2,1-3H3,(H,23,24) |
| InChIKey | VMZDRMSJYHGDEE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |