C26H35NO8S — CID 70003351
ethyl prop-2-enoate;2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid (PubChem CID 70003351) has the molecular formula C26H35NO8S and a molecular weight of 521.63 g/mol. Its IUPAC name is ethyl prop-2-enoate;2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid.
| Compound Name | ethyl prop-2-enoate;2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 70003351 |
| Molecular Formula | C26H35NO8S |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | ethyl prop-2-enoate;2-[[2-(4-methoxyphenyl)ethyl-(4-methoxyphenyl)sulfonylamino]methyl]butanoic acid |
| SMILES | C=CC(=O)OCC.CCC(CN(CCc1ccc(OC)cc1)S(=O)(=O)c1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C21H27NO6S.C5H8O2/c1-4-17(21(23)24)15-22(14-13-16-5-7-18(27-2)8-6-16)29(25,26)20-11-9-19(28-3)10-12-20;1-3-5(6)7-4-2/h5-12,17H,4,13-15H2,1-3H3,(H,23,24);3H,1,4H2,2H3 |
| InChIKey | CQIVGJNXBYWFJU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|