C27H32N4O5S — CID 59105584
N-hydroxy-3-[2-(4-methylphenyl)ethyl-[4-(2-phenylethylcarbamoylamino)phenyl]sulfonylamino]propanamide (PubChem CID 59105584) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is N-hydroxy-3-[2-(4-methylphenyl)ethyl-[4-(2-phenylethylcarbamoylamino)phenyl]sulfonylamino]propanamide.
| Compound Name | N-hydroxy-3-[2-(4-methylphenyl)ethyl-[4-(2-phenylethylcarbamoylamino)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 59105584 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-hydroxy-3-[2-(4-methylphenyl)ethyl-[4-(2-phenylethylcarbamoylamino)phenyl]sulfonylamino]propanamide |
| SMILES | Cc1ccc(CCN(CCC(=O)NO)S(=O)(=O)c2ccc(NC(=O)NCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O5S/c1-21-7-9-23(10-8-21)16-19-31(20-17-26(32)30-34)37(35,36)25-13-11-24(12-14-25)29-27(33)28-18-15-22-5-3-2-4-6-22/h2-14,34H,15-20H2,1H3,(H,30,32)(H2,28,29,33) |
| InChIKey | GABNMJUZRPLYSB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|