C26H30N4O5S — CID 59105595
3-[[4-(benzylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide (PubChem CID 59105595) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is 3-[[4-(benzylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide.
| Compound Name | 3-[[4-(benzylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 59105595 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[[4-(benzylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide |
| SMILES | Cc1ccc(CCN(CCC(=O)NO)S(=O)(=O)c2ccc(NC(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O5S/c1-20-7-9-21(10-8-20)15-17-30(18-16-25(31)29-33)36(34,35)24-13-11-23(12-14-24)28-26(32)27-19-22-5-3-2-4-6-22/h2-14,33H,15-19H2,1H3,(H,29,31)(H2,27,28,32) |
| InChIKey | FHLFRSRMZJFSGM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|