C31H32N4O5S — CID 59105586
3-[[4-(diphenylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide (PubChem CID 59105586) has the molecular formula C31H32N4O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is 3-[[4-(diphenylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide.
| Compound Name | 3-[[4-(diphenylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 59105586 |
| Molecular Formula | C31H32N4O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 3-[[4-(diphenylcarbamoylamino)phenyl]sulfonyl-[2-(4-methylphenyl)ethyl]amino]-N-hydroxypropanamide |
| SMILES | Cc1ccc(CCN(CCC(=O)NO)S(=O)(=O)c2ccc(NC(=O)N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H32N4O5S/c1-24-12-14-25(15-13-24)20-22-34(23-21-30(36)33-38)41(39,40)29-18-16-26(17-19-29)32-31(37)35(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-19,38H,20-23H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | CFPKLRMYXFIWJW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|