C23H21F3N2O4S — CID 126086784
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 126086784) has the molecular formula C23H21F3N2O4S and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126086784 |
| Molecular Formula | C23H21F3N2O4S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C(F)(F)F)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21F3N2O4S/c1-32-20-11-13-21(14-12-20)33(30,31)28(15-17-5-3-2-4-6-17)16-22(29)27-19-9-7-18(8-10-19)23(24,25)26/h2-14H,15-16H2,1H3,(H,27,29) |
| InChIKey | DFHCHCDTYQXNER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |