C28H23F3N2O4S — CID 1284888
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 1284888) has the molecular formula C28H23F3N2O4S and a molecular weight of 540.56 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1284888 |
| Molecular Formula | C28H23F3N2O4S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H23F3N2O4S/c1-37-23-15-17-24(18-16-23)38(35,36)33(19-20-7-3-2-4-8-20)26-10-6-5-9-25(26)27(34)32-22-13-11-21(12-14-22)28(29,30)31/h2-18H,19H2,1H3,(H,32,34) |
| InChIKey | RSVBMNNZSMHZKR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |