C17H19N3O7S — CID 10525561
N-hydroxy-3-[(4-methoxyphenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]propanamide (PubChem CID 10525561) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is N-hydroxy-3-[(4-methoxyphenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]propanamide.
| Compound Name | N-hydroxy-3-[(4-methoxyphenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 10525561 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-hydroxy-3-[(4-methoxyphenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)NO)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H19N3O7S/c1-27-15-6-8-16(9-7-15)28(25,26)19(11-10-17(21)18-22)12-13-2-4-14(5-3-13)20(23)24/h2-9,22H,10-12H2,1H3,(H,18,21) |
| InChIKey | ZCNGTOLWHNAQHJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|