C22H24N4O6S — CID 10552396
3-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide (PubChem CID 10552396) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide.
| Compound Name | 3-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10552396 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(CCC(=O)NO)Cc3ccc([N+](=O)[O-])cc3)cccc12 |
| InChI | InChI=1S/C22H24N4O6S/c1-24(2)20-7-3-6-19-18(20)5-4-8-21(19)33(31,32)25(14-13-22(27)23-28)15-16-9-11-17(12-10-16)26(29)30/h3-12,28H,13-15H2,1-2H3,(H,23,27) |
| InChIKey | NPUFWOCKSXLDBW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|