C16H15Cl2N3O6S — CID 10789615
3-[(2,5-dichlorophenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide (PubChem CID 10789615) has the molecular formula C16H15Cl2N3O6S and a molecular weight of 448.28 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10789615 |
| Molecular Formula | C16H15Cl2N3O6S |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfonyl-[(4-nitrophenyl)methyl]amino]-N-hydroxypropanamide |
| SMILES | O=C(CCN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1cc(Cl)ccc1Cl)NO |
| InChI | InChI=1S/C16H15Cl2N3O6S/c17-12-3-6-14(18)15(9-12)28(26,27)20(8-7-16(22)19-23)10-11-1-4-13(5-2-11)21(24)25/h1-6,9,23H,7-8,10H2,(H,19,22) |
| InChIKey | PZHSYSCOVAJWOX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|