C15H14N4O8S — CID 10573603
N-hydroxy-2-[(4-nitrophenyl)methyl-(2-nitrophenyl)sulfonylamino]acetamide (PubChem CID 10573603) has the molecular formula C15H14N4O8S and a molecular weight of 410.36 g/mol. Its IUPAC name is N-hydroxy-2-[(4-nitrophenyl)methyl-(2-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-hydroxy-2-[(4-nitrophenyl)methyl-(2-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 10573603 |
| Molecular Formula | C15H14N4O8S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-hydroxy-2-[(4-nitrophenyl)methyl-(2-nitrophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])NO |
| InChI | InChI=1S/C15H14N4O8S/c20-15(16-21)10-17(9-11-5-7-12(8-6-11)18(22)23)28(26,27)14-4-2-1-3-13(14)19(24)25/h1-8,21H,9-10H2,(H,16,20) |
| InChIKey | BITXXJKMASUYME-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|