C15H14ClN3O6S — CID 10763488
2-[benzyl-(3-chloro-4-nitrophenyl)sulfonylamino]-N-hydroxyacetamide (PubChem CID 10763488) has the molecular formula C15H14ClN3O6S and a molecular weight of 399.81 g/mol. Its IUPAC name is 2-[benzyl-(3-chloro-4-nitrophenyl)sulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-[benzyl-(3-chloro-4-nitrophenyl)sulfonylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10763488 |
| Molecular Formula | C15H14ClN3O6S |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-[benzyl-(3-chloro-4-nitrophenyl)sulfonylamino]-N-hydroxyacetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])c(Cl)c1)NO |
| InChI | InChI=1S/C15H14ClN3O6S/c16-13-8-12(6-7-14(13)19(22)23)26(24,25)18(10-15(20)17-21)9-11-4-2-1-3-5-11/h1-8,21H,9-10H2,(H,17,20) |
| InChIKey | ZNEMDDRWKURHMA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|