C22H20N4O5S — CID 2247598
2-[benzenesulfonyl(benzyl)amino]-N-[(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 2247598) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2247598 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccccc1)NN=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N4O5S/c27-22(24-23-15-19-11-7-8-14-21(19)26(28)29)17-25(16-18-9-3-1-4-10-18)32(30,31)20-12-5-2-6-13-20/h1-15H,16-17H2,(H,24,27) |
| InChIKey | FTXDWPWWANNCPL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|