C21H16Cl2N4O5S — CID 43879026
2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 43879026) has the molecular formula C21H16Cl2N4O5S and a molecular weight of 507.36 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43879026 |
| Molecular Formula | C21H16Cl2N4O5S |
| Molecular Weight | 507.36 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)N/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16Cl2N4O5S/c22-18-11-10-16(12-19(18)23)26(33(31,32)17-7-2-1-3-8-17)14-21(28)25-24-13-15-6-4-5-9-20(15)27(29)30/h1-13H,14H2,(H,25,28)/b24-13+ |
| InChIKey | RHBFFDWKZQBSJY-ZMOGYAJESA-N |
| XLogP | 4.25 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|