C25H20ClN5O6S — CID 21214985
2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide (PubChem CID 21214985) has the molecular formula C25H20ClN5O6S and a molecular weight of 553.98 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 21214985 |
| Molecular Formula | C25H20ClN5O6S |
| Molecular Weight | 553.98 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide |
| SMILES | COc1ccc2cc(/C=N/NC(=O)CN(c3ccccc3[N+](=O)[O-])S(=O)(=O)c3ccccc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H20ClN5O6S/c1-37-19-12-11-17-13-18(25(26)28-21(17)14-19)15-27-29-24(32)16-30(22-9-5-6-10-23(22)31(33)34)38(35,36)20-7-3-2-4-8-20/h2-15H,16H2,1H3,(H,29,32)/b27-15+ |
| InChIKey | MKZAFNMMEPKIJS-JFLMPSFJSA-N |
| XLogP | 4.15 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.98 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|