C25H26N4O8S — CID 98093714
2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide (PubChem CID 98093714) has the molecular formula C25H26N4O8S and a molecular weight of 542.57 g/mol. Its IUPAC name is 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98093714 |
| Molecular Formula | C25H26N4O8S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OC)c([N+](=O)[O-])c2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H26N4O8S/c1-35-22-11-9-19(13-21(22)29(31)32)15-26-27-25(30)17-28(16-18-7-5-4-6-8-18)38(33,34)20-10-12-23(36-2)24(14-20)37-3/h4-15H,16-17H2,1-3H3,(H,27,30)/b26-15- |
| InChIKey | IIBLFNLKAHDRHY-YSMPRRRNSA-N |
| XLogP | 2.96 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|