C24H22Cl2N4O6S — CID 126375515
2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide (PubChem CID 126375515) has the molecular formula C24H22Cl2N4O6S and a molecular weight of 565.44 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126375515 |
| Molecular Formula | C24H22Cl2N4O6S |
| Molecular Weight | 565.44 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22Cl2N4O6S/c1-36-22-10-7-18(13-21(22)30(32)33)15-27-28-24(31)16-29(12-11-17-5-3-2-4-6-17)37(34,35)23-14-19(25)8-9-20(23)26/h2-10,13-15H,11-12,16H2,1H3,(H,28,31)/b27-15- |
| InChIKey | CTHAQXPURFPTJJ-DICXZTSXSA-N |
| XLogP | 4.29 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|