C30H27Cl2N3O4S — CID 126022767
2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126022767) has the molecular formula C30H27Cl2N3O4S and a molecular weight of 596.54 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126022767 |
| Molecular Formula | C30H27Cl2N3O4S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(CCc1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl)N/N=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H27Cl2N3O4S/c31-26-14-15-28(32)29(19-26)40(37,38)35(17-16-23-8-3-1-4-9-23)21-30(36)34-33-20-25-12-7-13-27(18-25)39-22-24-10-5-2-6-11-24/h1-15,18-20H,16-17,21-22H2,(H,34,36)/b33-20- |
| InChIKey | SRKRGWFPFUXSBM-UCMJSZAQSA-N |
| XLogP | 5.96 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|