C18H24N8O2S — CID 71405546
N,N-bis(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 71405546) has the molecular formula C18H24N8O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is N,N-bis(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N,N-bis(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 71405546 |
| Molecular Formula | C18H24N8O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N,N-bis(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(CCCN=[N+]=[N-])CCCN=[N+]=[N-])cccc12 |
| InChI | InChI=1S/C18H24N8O2S/c1-25(2)17-9-3-8-16-15(17)7-4-10-18(16)29(27,28)26(13-5-11-21-23-19)14-6-12-22-24-20/h3-4,7-10H,5-6,11-14H2,1-2H3 |
| InChIKey | QTDCBVARNUWGKM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 138.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|