About 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide
5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide (PubChem CID 102092589) has the molecular formula C32H58N6O2S
and a molecular weight of 590.92 g/mol. Its IUPAC name is 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide |
| PubChem CID | 102092589 |
| Molecular Formula | C32H58N6O2S |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.43 |
| IUPAC Name | 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide |
| SMILES | CCNCCCCNCCCCN(CCCCNCCCCNCC)S(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C32H58N6O2S/c1-5-33-21-7-9-23-35-25-11-13-27-38(28-14-12-26-36-24-10-8-22-34-6-2)41(39,40)32-20-16-17-29-30(32)18-15-19-31(29)37(3)4/h15-20,33-36H,5-14,21-28H2,1-4H3 |
| InChIKey | CGUPZXKSWTWWIM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide?
The IUPAC name of 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide (CID 102092589) is 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide.
What is the SMILES notation for 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide?
The canonical SMILES for 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide is CCNCCCCNCCCCN(CCCCNCCCCNCC)S(=O)(=O)c1cccc2c(N(C)C)cccc12.
What is the InChIKey of 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide?
The InChIKey is CGUPZXKSWTWWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H58N6O2S/c1-5-33-21-7-9-23-35-25-11-13-27-38(28-14-12-26-36-24-10-8-22-34-6-2)41(39,40)32-20-16-17-29-30(32)18-15-19-31(29)37(3)4/h15-20,33-36H,5-14,21-28H2,1-4H3.
What are the key properties of 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide?
5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide has a molecular weight of 590.92 g/mol, XLogP of 4.42, 25 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N,N-bis[4-[4-(ethylamino)butylamino]butyl]naphthalene-1-sulfonamide is sourced from PubChem (CID 102092589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).