C17H18N2O6S — CID 10571679
3-[5-(dimethylamino)naphthalen-1-yl]sulfonyliminopentanedioic acid (PubChem CID 10571679) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-[5-(dimethylamino)naphthalen-1-yl]sulfonyliminopentanedioic acid.
| Compound Name | 3-[5-(dimethylamino)naphthalen-1-yl]sulfonyliminopentanedioic acid |
|---|---|
| PubChem CID | 10571679 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-[5-(dimethylamino)naphthalen-1-yl]sulfonyliminopentanedioic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N=C(CC(=O)O)CC(=O)O)cccc12 |
| InChI | InChI=1S/C17H18N2O6S/c1-19(2)14-7-3-6-13-12(14)5-4-8-15(13)26(24,25)18-11(9-16(20)21)10-17(22)23/h3-8H,9-10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | XQPSKTLOIXZJGW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|