C24H24N4O2S — CID 102189253
5-(dimethylamino)-N,N-bis(pyridin-2-ylmethyl)naphthalene-1-sulfonamide (PubChem CID 102189253) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-(dimethylamino)-N,N-bis(pyridin-2-ylmethyl)naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N,N-bis(pyridin-2-ylmethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 102189253 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-(dimethylamino)-N,N-bis(pyridin-2-ylmethyl)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(Cc3ccccn3)Cc3ccccn3)cccc12 |
| InChI | InChI=1S/C24H24N4O2S/c1-27(2)23-13-7-12-22-21(23)11-8-14-24(22)31(29,30)28(17-19-9-3-5-15-25-19)18-20-10-4-6-16-26-20/h3-16H,17-18H2,1-2H3 |
| InChIKey | HQRCVBLUPMYSCU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |