C27H35N5O5S- — CID 101257562
CID 101257562 (PubChem CID 101257562) has the molecular formula C27H35N5O5S- and a molecular weight of 541.67 g/mol.
| Compound Name | CID 101257562 |
|---|---|
| PubChem CID | 101257562 |
| Molecular Formula | C27H35N5O5S- |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | — |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(Cc3cccc(CO)n3)CC3N([O])C(C)(C)C(C)(C)N3[O-])cccc12 |
| InChI | InChI=1S/C27H35N5O5S/c1-26(2)27(3,4)32(35)25(31(26)34)17-30(16-19-10-7-11-20(18-33)28-19)38(36,37)24-15-9-12-21-22(24)13-8-14-23(21)29(5)6/h7-15,25,33H,16-18H2,1-6H3/q-1 |
| InChIKey | JXGRQJAPTNBTTM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |