C18H16BrClN2O — CID 27521635
N-[(Z)-[(4-bromophenyl)-cyclopropylmethylidene]amino]-2-(4-chlorophenyl)acetamide (PubChem CID 27521635) has the molecular formula C18H16BrClN2O and a molecular weight of 391.70 g/mol. Its IUPAC name is N-[(Z)-[(4-bromophenyl)-cyclopropylmethylidene]amino]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(Z)-[(4-bromophenyl)-cyclopropylmethylidene]amino]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 27521635 |
| Molecular Formula | C18H16BrClN2O |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | N-[(Z)-[(4-bromophenyl)-cyclopropylmethylidene]amino]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)N/N=C(\c1ccc(Br)cc1)C1CC1 |
| InChI | InChI=1S/C18H16BrClN2O/c19-15-7-5-14(6-8-15)18(13-3-4-13)22-21-17(23)11-12-1-9-16(20)10-2-12/h1-2,5-10,13H,3-4,11H2,(H,21,23)/b22-18- |
| InChIKey | MJMILHRMFWOOKC-PYCFMQQDSA-N |
| XLogP | 4.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|