C17H18BrClN3O2+ — CID 2698673
(4-bromophenyl)methyl-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylazanium (PubChem CID 2698673) has the molecular formula C17H18BrClN3O2+ and a molecular weight of 411.71 g/mol. Its IUPAC name is (4-bromophenyl)methyl-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylazanium.
| Compound Name | (4-bromophenyl)methyl-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2698673 |
| Molecular Formula | C17H18BrClN3O2+ |
| Molecular Weight | 411.71 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (4-bromophenyl)methyl-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NNC(=O)c1ccc(Cl)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrClN3O2/c1-22(10-12-2-6-14(18)7-3-12)11-16(23)20-21-17(24)13-4-8-15(19)9-5-13/h2-9H,10-11H2,1H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | XJVZPAYPRRGECH-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.71 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|