C20H25BrN3O2+ — CID 9028149
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9028149) has the molecular formula C20H25BrN3O2+ and a molecular weight of 419.34 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9028149 |
| Molecular Formula | C20H25BrN3O2+ |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](C)CC(=O)NNC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C20H24BrN3O2/c1-14(2)16-10-8-15(9-11-16)12-24(3)13-19(25)22-23-20(26)17-6-4-5-7-18(17)21/h4-11,14H,12-13H2,1-3H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | IVXCXEIZDWPMEF-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|