C15H22BrN4O3+ — CID 9289290
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 9289290) has the molecular formula C15H22BrN4O3+ and a molecular weight of 386.27 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9289290 |
| Molecular Formula | C15H22BrN4O3+ |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)CC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H21BrN4O3/c1-3-8-17-13(21)9-20(2)10-14(22)18-19-15(23)11-6-4-5-7-12(11)16/h4-7H,3,8-10H2,1-2H3,(H,17,21)(H,18,22)(H,19,23)/p+1 |
| InChIKey | YPXSKZFZDHZGRZ-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|