C17H23BrN2O4 — CID 3808941
2-[4-[2-(2-bromobenzoyl)hydrazinyl]-4-oxobutan-2-yl]hexanoic acid (PubChem CID 3808941) has the molecular formula C17H23BrN2O4 and a molecular weight of 399.29 g/mol. Its IUPAC name is 2-[4-[2-(2-bromobenzoyl)hydrazinyl]-4-oxobutan-2-yl]hexanoic acid.
| Compound Name | 2-[4-[2-(2-bromobenzoyl)hydrazinyl]-4-oxobutan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 3808941 |
| Molecular Formula | C17H23BrN2O4 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[4-[2-(2-bromobenzoyl)hydrazinyl]-4-oxobutan-2-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)C(C)CC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H23BrN2O4/c1-3-4-7-12(17(23)24)11(2)10-15(21)19-20-16(22)13-8-5-6-9-14(13)18/h5-6,8-9,11-12H,3-4,7,10H2,1-2H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | ZIZFFZTXGHFPIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|