C17H26N2O3 — CID 7453083
(2S)-5-methyl-2-[(2R)-4-oxo-4-(2-phenylhydrazinyl)butan-2-yl]hexanoic acid (PubChem CID 7453083) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-5-methyl-2-[(2R)-4-oxo-4-(2-phenylhydrazinyl)butan-2-yl]hexanoic acid.
| Compound Name | (2S)-5-methyl-2-[(2R)-4-oxo-4-(2-phenylhydrazinyl)butan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 7453083 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-5-methyl-2-[(2R)-4-oxo-4-(2-phenylhydrazinyl)butan-2-yl]hexanoic acid |
| SMILES | CC(C)CC[C@H](C(=O)O)[C@H](C)CC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C17H26N2O3/c1-12(2)9-10-15(17(21)22)13(3)11-16(20)19-18-14-7-5-4-6-8-14/h4-8,12-13,15,18H,9-11H2,1-3H3,(H,19,20)(H,21,22)/t13-,15+/m1/s1 |
| InChIKey | ZBNYJAPDHWMUDM-HIFRSBDPSA-N |
| XLogP | 3.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|