C15H22N2O5 — CID 2068410
(2S,3R)-5-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-2-(2-methylpropyl)-5-oxopentanoic acid (PubChem CID 2068410) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S,3R)-5-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-2-(2-methylpropyl)-5-oxopentanoic acid.
| Compound Name | (2S,3R)-5-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-2-(2-methylpropyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2068410 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S,3R)-5-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-2-(2-methylpropyl)-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](C(=O)O)[C@H](C)CC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H22N2O5/c1-9(2)7-11(15(20)21)10(3)8-13(18)16-17-14(19)12-5-4-6-22-12/h4-6,9-11H,7-8H2,1-3H3,(H,16,18)(H,17,19)(H,20,21)/t10-,11+/m1/s1 |
| InChIKey | RZEPMZPIPWSLFE-MNOVXSKESA-N |
| XLogP | 1.81 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|