C21H30N3O3+ — CID 9129533
[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium (PubChem CID 9129533) has the molecular formula C21H30N3O3+ and a molecular weight of 372.49 g/mol. Its IUPAC name is [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9129533 |
| Molecular Formula | C21H30N3O3+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
| SMILES | CC(C)[C@H]([NH2+]CC(=O)NNC(=O)c1ccco1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-14(2)19(15-8-10-16(11-9-15)21(3,4)5)22-13-18(25)23-24-20(26)17-7-6-12-27-17/h6-12,14,19,22H,13H2,1-5H3,(H,23,25)(H,24,26)/p+1/t19-/m0/s1 |
| InChIKey | ACPZNKXEULCUMX-IBGZPJMESA-O |
| XLogP | 2.30 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|