C23H32N3O2+ — CID 9129510
[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-(4-carbamoylanilino)-2-oxoethyl]azanium (PubChem CID 9129510) has the molecular formula C23H32N3O2+ and a molecular weight of 382.53 g/mol. Its IUPAC name is [(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-(4-carbamoylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-(4-carbamoylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9129510 |
| Molecular Formula | C23H32N3O2+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]-[2-(4-carbamoylanilino)-2-oxoethyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)Nc1ccc(C(N)=O)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-15(2)21(16-6-10-18(11-7-16)23(3,4)5)25-14-20(27)26-19-12-8-17(9-13-19)22(24)28/h6-13,15,21,25H,14H2,1-5H3,(H2,24,28)(H,26,27)/p+1/t21-/m1/s1 |
| InChIKey | UHOXLSUHECOPFQ-OAQYLSRUSA-O |
| XLogP | 2.98 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |