C20H25N2O3+ — CID 9131730
[2-(4-methoxycarbonylanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9131730) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9131730 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
| SMILES | COC(=O)c1ccc(NC(=O)C[NH2+][C@@H](c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-14(2)19(15-7-5-4-6-8-15)21-13-18(23)22-17-11-9-16(10-12-17)20(24)25-3/h4-12,14,19,21H,13H2,1-3H3,(H,22,23)/p+1/t19-/m1/s1 |
| InChIKey | NYRXDZPHPGYNCC-LJQANCHMSA-O |
| XLogP | 2.37 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |