C20H26N3O2+ — CID 9132977
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9132977) has the molecular formula C20H26N3O2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9132977 |
| Molecular Formula | C20H26N3O2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CNC(=O)c1ccc(NC(=O)C[NH2+][C@H](c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14(2)19(15-7-5-4-6-8-15)22-13-18(24)23-17-11-9-16(10-12-17)20(25)21-3/h4-12,14,19,22H,13H2,1-3H3,(H,21,25)(H,23,24)/p+1/t19-/m0/s1 |
| InChIKey | BIDMVUIVZCRAGR-IBGZPJMESA-O |
| XLogP | 1.95 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |