C24H33N3O2 — CID 9129619
4-[[(2S)-2-[[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]amino]benzamide (PubChem CID 9129619) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-[[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 9129619 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 4-[[(2S)-2-[[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]amino]benzamide |
| SMILES | CC(C)[C@@H](N[C@@H](C)C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-15(2)21(17-7-11-19(12-8-17)24(4,5)6)26-16(3)23(29)27-20-13-9-18(10-14-20)22(25)28/h7-16,21,26H,1-6H3,(H2,25,28)(H,27,29)/t16-,21+/m0/s1 |
| InChIKey | MRKSZQCVGAWBQU-HRAATJIYSA-N |
| XLogP | 4.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |