C22H30N2O — CID 18124565
4-[[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]methyl]benzamide (PubChem CID 18124565) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-[[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]methyl]benzamide.
| Compound Name | 4-[[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 18124565 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 4-[[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]methyl]benzamide |
| SMILES | CC(C)C(NCc1ccc(C(N)=O)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-15(2)20(17-10-12-19(13-11-17)22(3,4)5)24-14-16-6-8-18(9-7-16)21(23)25/h6-13,15,20,24H,14H2,1-5H3,(H2,23,25) |
| InChIKey | OAVYLRPVVRENRX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |