C19H30N2O3 — CID 9129796
methyl N-[(2R)-2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]carbamate (PubChem CID 9129796) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is methyl N-[(2R)-2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]carbamate.
| Compound Name | methyl N-[(2R)-2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]carbamate |
|---|---|
| PubChem CID | 9129796 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | methyl N-[(2R)-2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]propanoyl]carbamate |
| SMILES | COC(=O)NC(=O)[C@@H](C)N[C@H](c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C19H30N2O3/c1-12(2)16(20-13(3)17(22)21-18(23)24-7)14-8-10-15(11-9-14)19(4,5)6/h8-13,16,20H,1-7H3,(H,21,22,23)/t13-,16+/m1/s1 |
| InChIKey | NVCWGADKUGSTBE-CJNGLKHVSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |