C19H29NO — CID 30906945
N-[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]cyclobutanecarboxamide (PubChem CID 30906945) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]cyclobutanecarboxamide.
| Compound Name | N-[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 30906945 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]cyclobutanecarboxamide |
| SMILES | CC(C)[C@H](NC(=O)C1CCC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO/c1-13(2)17(20-18(21)15-7-6-8-15)14-9-11-16(12-10-14)19(3,4)5/h9-13,15,17H,6-8H2,1-5H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | GUJRFESAOUAVHA-KRWDZBQOSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |