C19H28N2O3 — CID 58417181
N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]cycloheptanecarboxamide (PubChem CID 58417181) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]cycloheptanecarboxamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 58417181 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]cycloheptanecarboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCCC1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-13(2)17(14-9-11-16(12-10-14)19(23)21-24)20-18(22)15-7-5-3-4-6-8-15/h9-13,15,17,24H,3-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | QYHNCZYOBCYVHF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|