C20H18F6N2O3 — CID 87384322
N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 87384322) has the molecular formula C20H18F6N2O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87384322 |
| Molecular Formula | C20H18F6N2O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[1-[4-(hydroxycarbamoyl)phenyl]-2-methylpropyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)C(NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C20H18F6N2O3/c1-10(2)16(11-3-5-12(6-4-11)18(30)28-31)27-17(29)13-7-14(19(21,22)23)9-15(8-13)20(24,25)26/h3-10,16,31H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | FIDNUXDNXFZIPQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|