C21H20F6N2O3 — CID 87383960
4-[1-[[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]amino]-2-methylpropyl]-N-hydroxybenzamide (PubChem CID 87383960) has the molecular formula C21H20F6N2O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is 4-[1-[[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]amino]-2-methylpropyl]-N-hydroxybenzamide.
| Compound Name | 4-[1-[[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]amino]-2-methylpropyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87383960 |
| Molecular Formula | C21H20F6N2O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 4-[1-[[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]amino]-2-methylpropyl]-N-hydroxybenzamide |
| SMILES | CC(C)C(NC(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C21H20F6N2O3/c1-11(2)18(13-3-5-14(6-4-13)19(31)29-32)28-17(30)9-12-7-15(20(22,23)24)10-16(8-12)21(25,26)27/h3-8,10-11,18,32H,9H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | ABNHSLRCNOMLLR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|