C17H22F3NO2 — CID 110016521
2-hydroxy-N-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]cyclopentane-1-carboxamide (PubChem CID 110016521) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-hydroxy-N-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]cyclopentane-1-carboxamide.
| Compound Name | 2-hydroxy-N-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110016521 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-hydroxy-N-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]cyclopentane-1-carboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCC1O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO2/c1-10(2)15(21-16(23)13-4-3-5-14(13)22)11-6-8-12(9-7-11)17(18,19)20/h6-10,13-15,22H,3-5H2,1-2H3,(H,21,23) |
| InChIKey | AAVOFBABASVZKZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |