C16H19BrN3O3+ — CID 8643284
[(1R)-1-(4-bromophenyl)propyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium (PubChem CID 8643284) has the molecular formula C16H19BrN3O3+ and a molecular weight of 381.25 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)propyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(4-bromophenyl)propyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8643284 |
| Molecular Formula | C16H19BrN3O3+ |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)propyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
| SMILES | CC[C@@H]([NH2+]CC(=O)NNC(=O)c1ccco1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrN3O3/c1-2-13(11-5-7-12(17)8-6-11)18-10-15(21)19-20-16(22)14-4-3-9-23-14/h3-9,13,18H,2,10H2,1H3,(H,19,21)(H,20,22)/p+1/t13-/m1/s1 |
| InChIKey | DTJFKMVSZPHEQK-CYBMUJFWSA-O |
| XLogP | 1.52 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|