C21H28BrN2O+ — CID 9263599
[(1R)-1-(4-bromophenyl)propyl]-[2-(2,6-diethylanilino)-2-oxoethyl]azanium (PubChem CID 9263599) has the molecular formula C21H28BrN2O+ and a molecular weight of 404.37 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)propyl]-[2-(2,6-diethylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(4-bromophenyl)propyl]-[2-(2,6-diethylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9263599 |
| Molecular Formula | C21H28BrN2O+ |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)propyl]-[2-(2,6-diethylanilino)-2-oxoethyl]azanium |
| SMILES | CCc1cccc(CC)c1NC(=O)C[NH2+][C@H](CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H27BrN2O/c1-4-15-8-7-9-16(5-2)21(15)24-20(25)14-23-19(6-3)17-10-12-18(22)13-11-17/h7-13,19,23H,4-6,14H2,1-3H3,(H,24,25)/p+1/t19-/m1/s1 |
| InChIKey | QVBFZZXGRPHLPS-LJQANCHMSA-O |
| XLogP | 4.23 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |