C11H11ClN4O — CID 10634467
N-[(E)-(1-amino-2-cyanoethylidene)amino]-2-(4-chlorophenyl)acetamide (PubChem CID 10634467) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is N-[(E)-(1-amino-2-cyanoethylidene)amino]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(E)-(1-amino-2-cyanoethylidene)amino]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 10634467 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-[(E)-(1-amino-2-cyanoethylidene)amino]-2-(4-chlorophenyl)acetamide |
| SMILES | N#CC/C(N)=N\NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClN4O/c12-9-3-1-8(2-4-9)7-11(17)16-15-10(14)5-6-13/h1-4H,5,7H2,(H2,14,15)(H,16,17) |
| InChIKey | VVRGEPMKSLTXPO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|