C15H19ClN2O3 — CID 19296203
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] cyclohexanecarboxylate (PubChem CID 19296203) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] cyclohexanecarboxylate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 19296203 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] cyclohexanecarboxylate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-20-13-8-7-11(16)9-12(13)14(17)18-21-15(19)10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H2,17,18) |
| InChIKey | ZKZBILWDSRSYKY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|