C11H12N3O4S- — CID 6901056
2-[2-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]oxyphenoxy]acetate (PubChem CID 6901056) has the molecular formula C11H12N3O4S- and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[2-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]oxyphenoxy]acetate.
| Compound Name | 2-[2-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]oxyphenoxy]acetate |
|---|---|
| PubChem CID | 6901056 |
| Molecular Formula | C11H12N3O4S- |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[2-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]oxyphenoxy]acetate |
| SMILES | C/C(=N/NC(N)=S)Oc1ccccc1OCC(=O)[O-] |
| InChI | InChI=1S/C11H13N3O4S/c1-7(13-14-11(12)19)18-9-5-3-2-4-8(9)17-6-10(15)16/h2-5H,6H2,1H3,(H,15,16)(H3,12,14,19)/p-1/b13-7- |
| InChIKey | RLCDMWXGECSOIQ-QPEQYQDCSA-M |
| XLogP | -0.64 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|